adelo77 adelo77
  • 03-11-2019
  • Mathematics
contestada

cosec(6b+pi/8)=sec(2b-pi/8)​

Respuesta :

2002hemal
2002hemal 2002hemal
  • 03-11-2019

Step-by-step explanation:

cosec( 6b+ pie/8)=sec(2b-pie/8)

1/ sin( 6b +pie/8)=1/sec(2b-pie/8)

cos(2b-pie/8)=sin(6b-pie/8)

cosX =sin(pie/2-x)

sin(pie/2-2b+pie/8)=sin(6b+pie/8)

pie/2-2b+pie/8=6b+pie/8

pie/2=8b

b = pie/16

Ver imagen 2002hemal
Answer Link

Otras preguntas

Which structure would be unaffected by the peripheral nervous system
what strategy to use
David bought a used car for $3000 and sold it later for $1000. What is the Approximate percent decrease in price of the car?
31 gallons of gas cost 82.15. what is the unit rate for 1 gallon of gas
Find the value in the ratio table...
How can you solve problems using equivalent expressions
How did the government use the Sherman Anti-Trust Act to end the Pulman Strike of 1894
How is the Mercator projection made
How many moles of n2(g) would contain exactly 4.0 moles of nitrogen atoms?
how many times greater is .03 than .00006?