jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

14 Calculate the mode from the following data: 7,8, 6, 5, 10, 11, 4, 5,2 b. 5: а. 3.' 4 6 с. d: 6

True or false? Phototropism only happens after plants move from darkness into the light. Group of answer choices False True

What was the Great Upheaval? Question 11 options: A) A mass strike that involved workers from different industries and from across the nation B) It was a larg

A government is trying to promote industrialization. It is concerning because the country has few banks able to finance expensive industrial enterprises. It rea

Role of theodussus to expansion of Christianity

1/f = 1/d + 1/d' How do I find d'?

Find the mean or average of these savings accounts $215, $156,$318, $75, and $25

The idea that the universe began from a single point and expanded to its current size explains a large number of observations, including those in the table belo

How do I find the image after it’s been rotated 270 degrees about the point (-2,-1)?

Br NaOCH2CH3 + CH3CH-OH + NaBr CH3 CH3 a. Identify the mechanism of the reaction. b. Suggest steps for the mechanism of this reaction. Use curved arrows to show